Home | IUPHAR/BPS Guide to PHARMACOLOGY
the iuphar/bps guide to pharmacology. an expert-driven guide to pharmacological targets with quantitative information on the prescription medicines and experimental drugs that act on them. developed as a joint initiative of the international union of basic and clinical pharmacology (iuphar) and the british pharmacological society (bps) and is now the new home of the iuphar database (iuphar-db).
Total Visits
Avg. Visit Duration
Pages per Visit
Bounce Rate
Registration Date
| Month | Traffic |
|---|---|
| 2025-02 | 86.219 |
| 2025-03 | 81.388 |
| 2025-04 | 75.639 |
| 2025-05 | 75.954 |
| Source | Traffic Share |
|---|---|
| search | 54.49% |
| direct | 32.55% |
| referrals | 9.97% |
| social | 2.18% |
| paid referrals | 0.59% |
| 0.15% |
| Region | Percentage |
|---|---|
| United States | 14.24% |
| RU | 9.79% |
| United Kingdom | 5.38% |
| Australia | 4.77% |
| KR | 4.65% |
| Keyword | Traffic | Volume | CPC |
|---|---|---|---|
| 5-hydroxytryptamine | 369 | 3,690 | $0.00 |
| ccs(=o)(=o)c1=cc=c(cnc(=o)c2=nc3=c(c=c2)c(=o)[c@](c)(cc3)c2=cc(c)=nc(c)=n2)c=c1 | 0 | 0 | $0.00 |
| iuphar | 156 | 1,560 | $0.00 |
| m5717 structure | 4 | 40 | $0.00 |
| met kinase and atpase activity | 3 | 30 | $0.00 |